C24H46O5Si2 — CID 102324239
2-trimethylsilylethyl (2E,6E,8S,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-10-methyl-11-oxoundeca-2,6-dienoate (PubChem CID 102324239) has the molecular formula C24H46O5Si2 and a molecular weight of 470.80 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,6E,8S,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-10-methyl-11-oxoundeca-2,6-dienoate.
| Compound Name | 2-trimethylsilylethyl (2E,6E,8S,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-10-methyl-11-oxoundeca-2,6-dienoate |
|---|---|
| PubChem CID | 102324239 |
| Molecular Formula | C24H46O5Si2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 2-trimethylsilylethyl (2E,6E,8S,9S,10S)-9-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-10-methyl-11-oxoundeca-2,6-dienoate |
| SMILES | CO[C@@H](/C=C/CC/C=C/C(=O)OCC[Si](C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C24H46O5Si2/c1-20(19-25)23(29-31(9,10)24(2,3)4)21(27-5)15-13-11-12-14-16-22(26)28-17-18-30(6,7)8/h13-16,19-21,23H,11-12,17-18H2,1-10H3/b15-13+,16-14+/t20-,21+,23+/m1/s1 |
| InChIKey | FTVZZFAURWIZEP-XDNFVNQISA-N |
| XLogP | 6.00 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|