C34H38F2N4O4 — CID 10232509
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-diethyl-5-(1,3-oxazol-2-yl)benzene-1,3-dicarboxamide (PubChem CID 10232509) has the molecular formula C34H38F2N4O4 and a molecular weight of 604.70 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-diethyl-5-(1,3-oxazol-2-yl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-diethyl-5-(1,3-oxazol-2-yl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10232509 |
| Molecular Formula | C34H38F2N4O4 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(3-ethylphenyl)methylamino]-3-hydroxybutan-2-yl]-3-N,3-N-diethyl-5-(1,3-oxazol-2-yl)benzene-1,3-dicarboxamide |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@H](Cc2cc(F)cc(F)c2)NC(=O)c2cc(C(=O)N(CC)CC)cc(-c3ncco3)c2)c1 |
| InChI | InChI=1S/C34H38F2N4O4/c1-4-22-8-7-9-23(12-22)20-37-21-31(41)30(15-24-13-28(35)19-29(36)14-24)39-32(42)25-16-26(33-38-10-11-44-33)18-27(17-25)34(43)40(5-2)6-3/h7-14,16-19,30-31,37,41H,4-6,15,20-21H2,1-3H3,(H,39,42)/t30-,31+/m0/s1 |
| InChIKey | OZWPGXCVCDQMKE-IOWSJCHKSA-N |
| XLogP | 5.16 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |