C15H16N2 — CID 102325231
4-methyl-8,9,10,11-tetrahydro-7H-indolo[1,2-b]indazole (PubChem CID 102325231) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4-methyl-8,9,10,11-tetrahydro-7H-indolo[1,2-b]indazole.
| Compound Name | 4-methyl-8,9,10,11-tetrahydro-7H-indolo[1,2-b]indazole |
|---|---|
| PubChem CID | 102325231 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-methyl-8,9,10,11-tetrahydro-7H-indolo[1,2-b]indazole |
| SMILES | Cc1cccc2c1-n1nc3c(c1C2)CCCC3 |
| InChI | InChI=1S/C15H16N2/c1-10-5-4-6-11-9-14-12-7-2-3-8-13(12)16-17(14)15(10)11/h4-6H,2-3,7-9H2,1H3 |
| InChIKey | ZBVOUXGOLTWCRX-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |