C26H52O5Si2 — CID 102325347
(2E,4E,6S,7S,8R,9S,10R)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-6,8,10-trimethylundeca-2,4-dienoic acid (PubChem CID 102325347) has the molecular formula C26H52O5Si2 and a molecular weight of 500.87 g/mol. Its IUPAC name is (2E,4E,6S,7S,8R,9S,10R)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-6,8,10-trimethylundeca-2,4-dienoic acid.
| Compound Name | (2E,4E,6S,7S,8R,9S,10R)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-6,8,10-trimethylundeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 102325347 |
| Molecular Formula | C26H52O5Si2 |
| Molecular Weight | 500.87 g/mol |
| Exact Mass | 500.34 |
| IUPAC Name | (2E,4E,6S,7S,8R,9S,10R)-9,11-bis[[tert-butyl(dimethyl)silyl]oxy]-7-hydroxy-6,8,10-trimethylundeca-2,4-dienoic acid |
| SMILES | C[C@H]([C@@H](O)[C@@H](C)/C=C/C=C/C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H52O5Si2/c1-19(16-14-15-17-22(27)28)23(29)21(3)24(31-33(12,13)26(7,8)9)20(2)18-30-32(10,11)25(4,5)6/h14-17,19-21,23-24,29H,18H2,1-13H3,(H,27,28)/b16-14+,17-15+/t19-,20+,21+,23-,24-/m0/s1 |
| InChIKey | WQUCDRXATULXCZ-WXBUCPPGSA-N |
| XLogP | 6.86 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.87 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|