C17H30N2O3 — CID 102325622
tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)but-3-enyl]-1,3-oxazolidine-3-carboxylate (PubChem CID 102325622) has the molecular formula C17H30N2O3 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)but-3-enyl]-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)but-3-enyl]-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 102325622 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tert-butyl (4R)-2,2-dimethyl-4-[(1S)-1-(prop-2-enylamino)but-3-enyl]-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CCN[C@@H](CC=C)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H30N2O3/c1-8-10-13(18-11-9-2)14-12-21-17(6,7)19(14)15(20)22-16(3,4)5/h8-9,13-14,18H,1-2,10-12H2,3-7H3/t13-,14-/m0/s1 |
| InChIKey | RWBLCOZHVANZQO-KBPBESRZSA-N |
| XLogP | 3.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|