C28H22O4S2 — CID 102325757
(1R,2R,3S,3aR,9bS)-9b-hydroxy-2,3-dithiophen-2-ylspiro[2,3,3a,4-tetrahydrocyclopenta[c]chromene-1,3'-2H-chromene]-4'-one (PubChem CID 102325757) has the molecular formula C28H22O4S2 and a molecular weight of 486.61 g/mol. Its IUPAC name is (1R,2R,3S,3aR,9bS)-9b-hydroxy-2,3-dithiophen-2-ylspiro[2,3,3a,4-tetrahydrocyclopenta[c]chromene-1,3'-2H-chromene]-4'-one.
| Compound Name | (1R,2R,3S,3aR,9bS)-9b-hydroxy-2,3-dithiophen-2-ylspiro[2,3,3a,4-tetrahydrocyclopenta[c]chromene-1,3'-2H-chromene]-4'-one |
|---|---|
| PubChem CID | 102325757 |
| Molecular Formula | C28H22O4S2 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (1R,2R,3S,3aR,9bS)-9b-hydroxy-2,3-dithiophen-2-ylspiro[2,3,3a,4-tetrahydrocyclopenta[c]chromene-1,3'-2H-chromene]-4'-one |
| SMILES | O=C1c2ccccc2OC[C@@]12[C@H](c1cccs1)[C@@H](c1cccs1)[C@@H]1COc3ccccc3[C@@]12O |
| InChI | InChI=1S/C28H22O4S2/c29-26-17-7-1-3-9-20(17)32-16-27(26)25(23-12-6-14-34-23)24(22-11-5-13-33-22)19-15-31-21-10-4-2-8-18(21)28(19,27)30/h1-14,19,24-25,30H,15-16H2/t19-,24+,25+,27+,28+/m0/s1 |
| InChIKey | KRJCKYCCFJSJEF-YBBSJMFESA-N |
| XLogP | 5.85 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |