C35H42FNO5Si — CID 102325814
(4R)-4-benzyl-3-[(Z,2R,3R)-8-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-3-hydroxy-2-methyloct-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102325814) has the molecular formula C35H42FNO5Si and a molecular weight of 603.81 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(Z,2R,3R)-8-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-3-hydroxy-2-methyloct-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(Z,2R,3R)-8-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-3-hydroxy-2-methyloct-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102325814 |
| Molecular Formula | C35H42FNO5Si |
| Molecular Weight | 603.81 g/mol |
| Exact Mass | 603.28 |
| IUPAC Name | (4R)-4-benzyl-3-[(Z,2R,3R)-8-[tert-butyl(diphenyl)silyl]oxy-4-fluoro-3-hydroxy-2-methyloct-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[C@@H](C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@H](O)/C(F)=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H42FNO5Si/c1-26(33(39)37-28(25-41-34(37)40)24-27-16-8-5-9-17-27)32(38)31(36)22-14-15-23-42-43(35(2,3)4,29-18-10-6-11-19-29)30-20-12-7-13-21-30/h5-13,16-22,26,28,32,38H,14-15,23-25H2,1-4H3/b31-22-/t26-,28-,32-/m1/s1 |
| InChIKey | GYYNZOZVYHFPHT-WIUWZQQASA-N |
| XLogP | 5.78 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.81 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|