C31H34O2 — CID 102326437
(12cR,12dR)-2,7-ditert-butyl-12c,12d-dimethylbenzo[e]pyrene-10-carboxylic acid (PubChem CID 102326437) has the molecular formula C31H34O2 and a molecular weight of 438.61 g/mol. Its IUPAC name is (12cR,12dR)-2,7-ditert-butyl-12c,12d-dimethylbenzo[e]pyrene-10-carboxylic acid.
| Compound Name | (12cR,12dR)-2,7-ditert-butyl-12c,12d-dimethylbenzo[e]pyrene-10-carboxylic acid |
|---|---|
| PubChem CID | 102326437 |
| Molecular Formula | C31H34O2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (12cR,12dR)-2,7-ditert-butyl-12c,12d-dimethylbenzo[e]pyrene-10-carboxylic acid |
| SMILES | CC(C)(C)C1=CC2=c3ccc(C(=O)O)cc3=C3C=C(C(C)(C)C)C=C4C=CC(=C1)[C@@]2(C)[C@]43C |
| InChI | InChI=1S/C31H34O2/c1-28(2,3)21-14-19-10-11-20-15-22(29(4,5)6)17-26-24-13-18(27(32)33)9-12-23(24)25(16-21)30(19,7)31(20,26)8/h9-17H,1-8H3,(H,32,33)/t30-,31-/m1/s1 |
| InChIKey | GZKJXHOVZDFJKD-FIRIVFDPSA-N |
| XLogP | 6.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |