C40H38O5 — CID 102326500
[(2R,3S,6R)-6-naphthalen-1-yloxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate (PubChem CID 102326500) has the molecular formula C40H38O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is [(2R,3S,6R)-6-naphthalen-1-yloxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,3S,6R)-6-naphthalen-1-yloxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102326500 |
| Molecular Formula | C40H38O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | [(2R,3S,6R)-6-naphthalen-1-yloxy-2-(trityloxymethyl)-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1C=C[C@@H](Oc2cccc3ccccc23)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H38O5/c1-39(2,3)38(41)45-35-26-27-37(43-34-25-15-17-29-16-13-14-24-33(29)34)44-36(35)28-42-40(30-18-7-4-8-19-30,31-20-9-5-10-21-31)32-22-11-6-12-23-32/h4-27,35-37H,28H2,1-3H3/t35-,36+,37-/m0/s1 |
| InChIKey | MLGITXQKPYHOKC-QOEXFKEZSA-N |
| XLogP | 8.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|