C30H32N2O2 — CID 102326566
(1S,9S,11R)-11-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-4-methoxy-1-naphthalen-1-yl-10-oxa-8-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 102326566) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (1S,9S,11R)-11-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-4-methoxy-1-naphthalen-1-yl-10-oxa-8-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | (1S,9S,11R)-11-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-4-methoxy-1-naphthalen-1-yl-10-oxa-8-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 102326566 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (1S,9S,11R)-11-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-4-methoxy-1-naphthalen-1-yl-10-oxa-8-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H]1O[C@H]2C[C@]1(c1cccc3ccccc13)c1cc(OC)ccc1N2 |
| InChI | InChI=1S/C30H32N2O2/c1-3-19-18-32-14-13-21(19)15-27(32)29-30(24-10-6-8-20-7-4-5-9-23(20)24)17-28(34-29)31-26-12-11-22(33-2)16-25(26)30/h3-12,16,19,21,27-29,31H,1,13-15,17-18H2,2H3/t19-,21-,27+,28-,29-,30-/m0/s1 |
| InChIKey | MIVJGSAJVBIIHT-OUVGPXMUSA-N |
| XLogP | 5.57 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|