About (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol
(6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol (PubChem CID 102326632) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol.
Molecular Properties
| Compound Name | (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol |
| PubChem CID | 102326632 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol |
| SMILES | Cc1cc2c(c(CO)n1)COC2 |
| InChI | InChI=1S/C9H11NO2/c1-6-2-7-4-12-5-8(7)9(3-11)10-6/h2,11H,3-5H2,1H3 |
| InChIKey | YVZPZFWCKNASIB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol?
The IUPAC name of (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol (CID 102326632) is (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol.
What is the SMILES notation for (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol?
The canonical SMILES for (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol is Cc1cc2c(c(CO)n1)COC2.
What is the InChIKey of (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol?
The InChIKey is YVZPZFWCKNASIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-6-2-7-4-12-5-8(7)9(3-11)10-6/h2,11H,3-5H2,1H3.
What are the key properties of (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol?
(6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol has a molecular weight of 165.19 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methyl-1,3-dihydrofuro[3,4-c]pyridin-4-yl)methanol is sourced from PubChem (CID 102326632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).