C19H31NOSi — CID 102326670
(3R,4S,5R)-3-butyl-4-[dimethyl(phenyl)silyl]-5-ethyl-3-methylpyrrolidin-2-one (PubChem CID 102326670) has the molecular formula C19H31NOSi and a molecular weight of 317.55 g/mol. Its IUPAC name is (3R,4S,5R)-3-butyl-4-[dimethyl(phenyl)silyl]-5-ethyl-3-methylpyrrolidin-2-one.
| Compound Name | (3R,4S,5R)-3-butyl-4-[dimethyl(phenyl)silyl]-5-ethyl-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102326670 |
| Molecular Formula | C19H31NOSi |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | (3R,4S,5R)-3-butyl-4-[dimethyl(phenyl)silyl]-5-ethyl-3-methylpyrrolidin-2-one |
| SMILES | CCCC[C@]1(C)C(=O)N[C@H](CC)[C@H]1[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H31NOSi/c1-6-8-14-19(3)17(16(7-2)20-18(19)21)22(4,5)15-12-10-9-11-13-15/h9-13,16-17H,6-8,14H2,1-5H3,(H,20,21)/t16-,17-,19+/m1/s1 |
| InChIKey | RIMSIAVAZLTROE-LMMKCTJWSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|