C20H11N5O2 — CID 102326905
22-nitro-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1(20),3(22),4,6,8(24),9,11,13(23),14,16,18-undecaene (PubChem CID 102326905) has the molecular formula C20H11N5O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 22-nitro-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1(20),3(22),4,6,8(24),9,11,13(23),14,16,18-undecaene.
| Compound Name | 22-nitro-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1(20),3(22),4,6,8(24),9,11,13(23),14,16,18-undecaene |
|---|---|
| PubChem CID | 102326905 |
| Molecular Formula | C20H11N5O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 22-nitro-2,21,23,24-tetrazahexacyclo[13.5.1.13,20.15,8.110,13.018,21]tetracosa-1(20),3(22),4,6,8(24),9,11,13(23),14,16,18-undecaene |
| SMILES | O=[N+]([O-])c1c2[nH]c3c1cc1cc/c(n13)=C/C1=N/C(=C\C3=N/C(=C\2)C=C3)C=C1 |
| InChI | InChI=1S/C20H11N5O2/c26-25(27)19-17-10-16-6-5-15-8-13-3-1-11(21-13)7-12-2-4-14(22-12)9-18(19)23-20(17)24(15)16/h1-10,23H/b11-7-,14-9-,15-8- |
| InChIKey | OLYJKEHEDVRALD-WUNWFQNQSA-N |
| XLogP | 3.09 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|