C13H20O5 — CID 102327030
(1R,3S,7S,10S)-7-methoxy-2,6,11-trioxatricyclo[8.5.0.03,7]pentadecan-5-one (PubChem CID 102327030) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (1R,3S,7S,10S)-7-methoxy-2,6,11-trioxatricyclo[8.5.0.03,7]pentadecan-5-one.
| Compound Name | (1R,3S,7S,10S)-7-methoxy-2,6,11-trioxatricyclo[8.5.0.03,7]pentadecan-5-one |
|---|---|
| PubChem CID | 102327030 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (1R,3S,7S,10S)-7-methoxy-2,6,11-trioxatricyclo[8.5.0.03,7]pentadecan-5-one |
| SMILES | CO[C@]12CC[C@@H]3OCCCC[C@H]3O[C@H]1CC(=O)O2 |
| InChI | InChI=1S/C13H20O5/c1-15-13-6-5-9-10(4-2-3-7-16-9)17-11(13)8-12(14)18-13/h9-11H,2-8H2,1H3/t9-,10+,11-,13-/m0/s1 |
| InChIKey | IEPWNLOGTQCJBA-NOHGZBONSA-N |
| XLogP | 1.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |