About 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one
5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one (PubChem CID 102327034) has the molecular formula C19H34O5Si
and a molecular weight of 370.56 g/mol. Its IUPAC name is 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one.
Molecular Properties
| Compound Name | 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one |
| PubChem CID | 102327034 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one |
| SMILES | COC1(CC[C@@H]2OCCCC[C@@H]2O[Si](C)(C)C(C)(C)C)C=CC(=O)O1 |
| InChI | InChI=1S/C19H34O5Si/c1-18(2,3)25(5,6)24-16-9-7-8-14-22-15(16)10-12-19(21-4)13-11-17(20)23-19/h11,13,15-16H,7-10,12,14H2,1-6H3/t15-,16-,19?/m0/s1 |
| InChIKey | FHMXUSUCBQXTIE-NRAVZPKASA-N |
| XLogP | 4.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one?
The IUPAC name of 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one (CID 102327034) is 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one.
What is the SMILES notation for 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one?
The canonical SMILES for 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one is COC1(CC[C@@H]2OCCCC[C@@H]2O[Si](C)(C)C(C)(C)C)C=CC(=O)O1.
What is the InChIKey of 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one?
The InChIKey is FHMXUSUCBQXTIE-NRAVZPKASA-N. The full InChI is InChI=1S/C19H34O5Si/c1-18(2,3)25(5,6)24-16-9-7-8-14-22-15(16)10-12-19(21-4)13-11-17(20)23-19/h11,13,15-16H,7-10,12,14H2,1-6H3/t15-,16-,19?/m0/s1.
What are the key properties of 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one?
5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one has a molecular weight of 370.56 g/mol, XLogP of 4.18, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxepan-2-yl]ethyl]-5-methoxyfuran-2-one is sourced from PubChem (CID 102327034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).