About (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol
(3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol (PubChem CID 102327181) has the molecular formula C9H16O2S
and a molecular weight of 188.29 g/mol. Its IUPAC name is (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol.
Molecular Properties
| Compound Name | (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol |
| PubChem CID | 102327181 |
| Molecular Formula | C9H16O2S |
| Molecular Weight | 188.29 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol |
| SMILES | CCCCCC1=C[C@H](O)CS1=O |
| InChI | InChI=1S/C9H16O2S/c1-2-3-4-5-9-6-8(10)7-12(9)11/h6,8,10H,2-5,7H2,1H3/t8-,12?/m0/s1 |
| InChIKey | TUWIJUMMAMSDOS-KBPLZSHQSA-N |
| XLogP | 1.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.29 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol?
The IUPAC name of (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol (CID 102327181) is (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol.
What is the SMILES notation for (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol?
The canonical SMILES for (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol is CCCCCC1=C[C@H](O)CS1=O.
What is the InChIKey of (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol?
The InChIKey is TUWIJUMMAMSDOS-KBPLZSHQSA-N. The full InChI is InChI=1S/C9H16O2S/c1-2-3-4-5-9-6-8(10)7-12(9)11/h6,8,10H,2-5,7H2,1H3/t8-,12?/m0/s1.
What are the key properties of (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol?
(3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol has a molecular weight of 188.29 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-oxo-5-pentyl-2,3-dihydrothiophen-3-ol is sourced from PubChem (CID 102327181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).