About trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide
trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide (PubChem CID 102327290) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide |
| PubChem CID | 102327290 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide |
| SMILES | CC(C)N(C(=O)[C@@]1(C)C[C@@H]1c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H25NO/c1-12(2)18(13(3)4)16(19)17(5)11-15(17)14-9-7-6-8-10-14/h6-10,12-13,15H,11H2,1-5H3/t15-,17+/m1/s1 |
| InChIKey | RCFSGSCWRGTJPR-WBVHZDCISA-N |
| XLogP | 3.83 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide?
The IUPAC name of trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide (CID 102327290) is trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide.
What is the SMILES notation for trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide?
The canonical SMILES for trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide is CC(C)N(C(=O)[C@@]1(C)C[C@@H]1c1ccccc1)C(C)C.
What is the InChIKey of trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide?
The InChIKey is RCFSGSCWRGTJPR-WBVHZDCISA-N. The full InChI is InChI=1S/C17H25NO/c1-12(2)18(13(3)4)16(19)17(5)11-15(17)14-9-7-6-8-10-14/h6-10,12-13,15H,11H2,1-5H3/t15-,17+/m1/s1.
What are the key properties of trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide?
trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide has a molecular weight of 259.39 g/mol, XLogP of 3.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-1-methyl-2-phenyl-N,N-di(propan-2-yl)cyclopropane-1-carboxamide is sourced from PubChem (CID 102327290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).