C19H24O4 — CID 102328126
(1R,12S,13R,15S)-13,15-bis(ethenyl)-6,7-dimethylidene-3,10-dioxabicyclo[10.3.0]pentadecane-2,11-dione (PubChem CID 102328126) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (1R,12S,13R,15S)-13,15-bis(ethenyl)-6,7-dimethylidene-3,10-dioxabicyclo[10.3.0]pentadecane-2,11-dione.
| Compound Name | (1R,12S,13R,15S)-13,15-bis(ethenyl)-6,7-dimethylidene-3,10-dioxabicyclo[10.3.0]pentadecane-2,11-dione |
|---|---|
| PubChem CID | 102328126 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (1R,12S,13R,15S)-13,15-bis(ethenyl)-6,7-dimethylidene-3,10-dioxabicyclo[10.3.0]pentadecane-2,11-dione |
| SMILES | C=C[C@@H]1C[C@H](C=C)[C@@H]2C(=O)OCCC(=C)C(=C)CCOC(=O)[C@@H]21 |
| InChI | InChI=1S/C19H24O4/c1-5-14-11-15(6-2)17-16(14)18(20)22-9-7-12(3)13(4)8-10-23-19(17)21/h5-6,14-17H,1-4,7-11H2/t14-,15+,16-,17+ |
| InChIKey | UJNNQEWZPMCFBP-WNKDZCFJSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|