C18H12O2S2 — CID 102328231
(1R,2S,11R,12S)-10,13-dithiapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-9,14-dione (PubChem CID 102328231) has the molecular formula C18H12O2S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is (1R,2S,11R,12S)-10,13-dithiapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-9,14-dione.
| Compound Name | (1R,2S,11R,12S)-10,13-dithiapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-9,14-dione |
|---|---|
| PubChem CID | 102328231 |
| Molecular Formula | C18H12O2S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | (1R,2S,11R,12S)-10,13-dithiapentacyclo[10.8.0.02,11.03,8.015,20]icosa-3,5,7,15,17,19-hexaene-9,14-dione |
| SMILES | O=C1S[C@@H]2[C@@H]3SC(=O)c4ccccc4[C@@H]3[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C18H12O2S2/c19-17-11-7-3-1-5-9(11)13-14-10-6-2-4-8-12(10)18(20)22-16(14)15(13)21-17/h1-8,13-16H/t13-,14+,15-,16+ |
| InChIKey | JUBXELDBGDRADA-GEEKYZPCSA-N |
| XLogP | 4.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|