About CID 102328489
CID 102328489 (PubChem CID 102328489) has the molecular formula C30H39NO3Si
and a molecular weight of 489.73 g/mol.
Molecular Properties
| Compound Name | CID 102328489 |
| PubChem CID | 102328489 |
| Molecular Formula | C30H39NO3Si |
| Molecular Weight | 489.73 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | — |
| SMILES | CN1c2ccccc2C2(OOC23C2CC4CC(C2)CC3C4)c2cccc(O[Si](C)(C)C(C)(C)C)c21 |
| InChI | InChI=1S/C30H39NO3Si/c1-28(2,3)35(5,6)32-26-13-9-11-24-27(26)31(4)25-12-8-7-10-23(25)30(24)29(33-34-30)21-15-19-14-20(17-21)18-22(29)16-19/h7-13,19-22H,14-18H2,1-6H3 |
| InChIKey | WXFCFDXHMYQTRV-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.73 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 102328489 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 102328489?
The IUPAC name of CID 102328489 (CID 102328489) is not available.
What is the SMILES notation for CID 102328489?
The canonical SMILES for CID 102328489 is CN1c2ccccc2C2(OOC23C2CC4CC(C2)CC3C4)c2cccc(O[Si](C)(C)C(C)(C)C)c21.
What is the InChIKey of CID 102328489?
The InChIKey is WXFCFDXHMYQTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H39NO3Si/c1-28(2,3)35(5,6)32-26-13-9-11-24-27(26)31(4)25-12-8-7-10-23(25)30(24)29(33-34-30)21-15-19-14-20(17-21)18-22(29)16-19/h7-13,19-22H,14-18H2,1-6H3.
What are the key properties of CID 102328489?
CID 102328489 has a molecular weight of 489.73 g/mol, XLogP of 7.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 102328489 is sourced from PubChem (CID 102328489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).