C21H16F17NO3 — CID 102328777
propan-2-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyphenyl)iminoundecanoate (PubChem CID 102328777) has the molecular formula C21H16F17NO3 and a molecular weight of 653.33 g/mol. Its IUPAC name is propan-2-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyphenyl)iminoundecanoate.
| Compound Name | propan-2-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyphenyl)iminoundecanoate |
|---|---|
| PubChem CID | 102328777 |
| Molecular Formula | C21H16F17NO3 |
| Molecular Weight | 653.33 g/mol |
| Exact Mass | 653.09 |
| IUPAC Name | propan-2-yl 4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,11-heptadecafluoro-3-(4-methoxyphenyl)iminoundecanoate |
| SMILES | COc1ccc(/N=C(\CC(=O)OC(C)C)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H16F17NO3/c1-9(2)42-13(40)8-12(39-10-4-6-11(41-3)7-5-10)14(22,23)15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38/h4-7,9H,8H2,1-3H3/b39-12+ |
| InChIKey | HQCMJYATHNIRQS-AQUGMHQTSA-N |
| XLogP | 8.12 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.33 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|