C21H19F3N2O4 — CID 102328779
(4S)-4-benzyl-3-[(Z)-4,4,4-trifluoro-3-(4-methoxyanilino)but-2-enoyl]-1,3-oxazolidin-2-one (PubChem CID 102328779) has the molecular formula C21H19F3N2O4 and a molecular weight of 420.39 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(Z)-4,4,4-trifluoro-3-(4-methoxyanilino)but-2-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(Z)-4,4,4-trifluoro-3-(4-methoxyanilino)but-2-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102328779 |
| Molecular Formula | C21H19F3N2O4 |
| Molecular Weight | 420.39 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (4S)-4-benzyl-3-[(Z)-4,4,4-trifluoro-3-(4-methoxyanilino)but-2-enoyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(N/C(=C\C(=O)N2C(=O)OC[C@@H]2Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N2O4/c1-29-17-9-7-15(8-10-17)25-18(21(22,23)24)12-19(27)26-16(13-30-20(26)28)11-14-5-3-2-4-6-14/h2-10,12,16,25H,11,13H2,1H3/b18-12-/t16-/m0/s1 |
| InChIKey | OJZOFXRMEJJMQF-JIHKLPAASA-N |
| XLogP | 4.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|