C21H23IO4S2 — CID 102329851
[(2S,3R,4R)-1-(benzenesulfonyl)-4-ethenyl-3-(iodomethyl)-2-methylcyclopentyl]sulfonylbenzene (PubChem CID 102329851) has the molecular formula C21H23IO4S2 and a molecular weight of 530.45 g/mol. Its IUPAC name is [(2S,3R,4R)-1-(benzenesulfonyl)-4-ethenyl-3-(iodomethyl)-2-methylcyclopentyl]sulfonylbenzene.
| Compound Name | [(2S,3R,4R)-1-(benzenesulfonyl)-4-ethenyl-3-(iodomethyl)-2-methylcyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102329851 |
| Molecular Formula | C21H23IO4S2 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | [(2S,3R,4R)-1-(benzenesulfonyl)-4-ethenyl-3-(iodomethyl)-2-methylcyclopentyl]sulfonylbenzene |
| SMILES | C=C[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)[C@@H](C)[C@@H]1CI |
| InChI | InChI=1S/C21H23IO4S2/c1-3-17-14-21(16(2)20(17)15-22,27(23,24)18-10-6-4-7-11-18)28(25,26)19-12-8-5-9-13-19/h3-13,16-17,20H,1,14-15H2,2H3/t16-,17-,20-/m0/s1 |
| InChIKey | PQWQAWIEXSKQCC-ZWOKBUDYSA-N |
| XLogP | 4.52 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|