C20H22O4S2 — CID 102329857
[(3R,4S)-1-(benzenesulfonyl)-3-ethenyl-4-methylcyclopentyl]sulfonylbenzene (PubChem CID 102329857) has the molecular formula C20H22O4S2 and a molecular weight of 390.53 g/mol. Its IUPAC name is [(3R,4S)-1-(benzenesulfonyl)-3-ethenyl-4-methylcyclopentyl]sulfonylbenzene.
| Compound Name | [(3R,4S)-1-(benzenesulfonyl)-3-ethenyl-4-methylcyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102329857 |
| Molecular Formula | C20H22O4S2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | [(3R,4S)-1-(benzenesulfonyl)-3-ethenyl-4-methylcyclopentyl]sulfonylbenzene |
| SMILES | C=C[C@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C20H22O4S2/c1-3-17-15-20(14-16(17)2,25(21,22)18-10-6-4-7-11-18)26(23,24)19-12-8-5-9-13-19/h3-13,16-17H,1,14-15H2,2H3/t16-,17-/m0/s1 |
| InChIKey | SUHNEGFBLWOJQV-IRXDYDNUSA-N |
| XLogP | 3.86 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|