About [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene
[(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene (PubChem CID 102329862) has the molecular formula C20H21IO4S2
and a molecular weight of 516.42 g/mol. Its IUPAC name is [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene.
Molecular Properties
| Compound Name | [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene |
| PubChem CID | 102329862 |
| Molecular Formula | C20H21IO4S2 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene |
| SMILES | C=C[C@@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H]1CI |
| InChI | InChI=1S/C20H21IO4S2/c1-2-16-13-20(14-17(16)15-21,26(22,23)18-9-5-3-6-10-18)27(24,25)19-11-7-4-8-12-19/h2-12,16-17H,1,13-15H2/t16-,17+/m1/s1 |
| InChIKey | HXBPQOOGSXKODR-SJORKVTESA-N |
| XLogP | 4.28 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene?
The IUPAC name of [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene (CID 102329862) is [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene.
What is the SMILES notation for [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene?
The canonical SMILES for [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene is C=C[C@@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H]1CI.
What is the InChIKey of [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene?
The InChIKey is HXBPQOOGSXKODR-SJORKVTESA-N. The full InChI is InChI=1S/C20H21IO4S2/c1-2-16-13-20(14-17(16)15-21,26(22,23)18-9-5-3-6-10-18)27(24,25)19-11-7-4-8-12-19/h2-12,16-17H,1,13-15H2/t16-,17+/m1/s1.
What are the key properties of [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene?
[(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene has a molecular weight of 516.42 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene is sourced from PubChem (CID 102329862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).