C20H21IO4S2 — CID 102329862
[(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene (PubChem CID 102329862) has the molecular formula C20H21IO4S2 and a molecular weight of 516.42 g/mol. Its IUPAC name is [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene.
| Compound Name | [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102329862 |
| Molecular Formula | C20H21IO4S2 |
| Molecular Weight | 516.42 g/mol |
| Exact Mass | 515.99 |
| IUPAC Name | [(3S,4R)-1-(benzenesulfonyl)-3-ethenyl-4-(iodomethyl)cyclopentyl]sulfonylbenzene |
| SMILES | C=C[C@@H]1CC(S(=O)(=O)c2ccccc2)(S(=O)(=O)c2ccccc2)C[C@H]1CI |
| InChI | InChI=1S/C20H21IO4S2/c1-2-16-13-20(14-17(16)15-21,26(22,23)18-9-5-3-6-10-18)27(24,25)19-11-7-4-8-12-19/h2-12,16-17H,1,13-15H2/t16-,17+/m1/s1 |
| InChIKey | HXBPQOOGSXKODR-SJORKVTESA-N |
| XLogP | 4.28 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|