C27H30F6N6O5 — CID 10232991
[(2R)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate (PubChem CID 10232991) has the molecular formula C27H30F6N6O5 and a molecular weight of 632.56 g/mol. Its IUPAC name is [(2R)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate.
| Compound Name | [(2R)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate |
|---|---|
| PubChem CID | 10232991 |
| Molecular Formula | C27H30F6N6O5 |
| Molecular Weight | 632.56 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | [(2R)-1-[5-[3,5-bis(trifluoromethyl)phenyl]-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutan-2-yl] N-[(3S)-1,2-dioxo-1-(1H-pyrazol-5-ylamino)heptan-3-yl]carbamate |
| SMILES | CCCC[C@H](NC(=O)O[C@H](Cc1nnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1)C(C)(C)C)C(=O)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C27H30F6N6O5/c1-5-6-7-17(21(40)22(41)36-19-8-9-34-37-19)35-24(42)43-18(25(2,3)4)13-20-38-39-23(44-20)14-10-15(26(28,29)30)12-16(11-14)27(31,32)33/h8-12,17-18H,5-7,13H2,1-4H3,(H,35,42)(H2,34,36,37,41)/t17-,18+/m0/s1 |
| InChIKey | JSOOGJOPEWFAHE-ZWKOTPCHSA-N |
| XLogP | 5.95 |
| TPSA | 152.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.56 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|