C15H30O4Si — CID 102330142
methyl (3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2-methylidenehexanoate (PubChem CID 102330142) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is methyl (3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2-methylidenehexanoate.
| Compound Name | methyl (3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2-methylidenehexanoate |
|---|---|
| PubChem CID | 102330142 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | methyl (3S,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-3-methyl-2-methylidenehexanoate |
| SMILES | C=C(C(=O)OC)[C@H](C)[C@H](O)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O4Si/c1-10(11(2)14(17)18-7)13(16)12(3)19-20(8,9)15(4,5)6/h10,12-13,16H,2H2,1,3-9H3/t10-,12+,13-/m0/s1 |
| InChIKey | RAZMBHPFUGVUOF-UHTWSYAYSA-N |
| XLogP | 3.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|