C19H23NO4 — CID 102330382
(4R,5S)-3-[(2R,3S)-3-hydroxy-2-methyloct-7-ynoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 102330382) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is (4R,5S)-3-[(2R,3S)-3-hydroxy-2-methyloct-7-ynoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(2R,3S)-3-hydroxy-2-methyloct-7-ynoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102330382 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (4R,5S)-3-[(2R,3S)-3-hydroxy-2-methyloct-7-ynoyl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | C#CCCC[C@H](O)[C@@H](C)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C |
| InChI | InChI=1S/C19H23NO4/c1-4-5-7-12-16(21)13(2)18(22)20-14(3)17(24-19(20)23)15-10-8-6-9-11-15/h1,6,8-11,13-14,16-17,21H,5,7,12H2,2-3H3/t13-,14-,16+,17-/m1/s1 |
| InChIKey | KBHBIARNCJBRND-TXCZRRACSA-N |
| XLogP | 2.90 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|