C15H30NNaO3 — CID 102330391
sodium 2-[2-hydroxydodecyl(methyl)amino]acetate (PubChem CID 102330391) has the molecular formula C15H30NNaO3 and a molecular weight of 295.40 g/mol. Its IUPAC name is sodium 2-[2-hydroxydodecyl(methyl)amino]acetate.
| Compound Name | sodium 2-[2-hydroxydodecyl(methyl)amino]acetate |
|---|---|
| PubChem CID | 102330391 |
| Molecular Formula | C15H30NNaO3 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | sodium 2-[2-hydroxydodecyl(methyl)amino]acetate |
| SMILES | CCCCCCCCCCC(O)CN(C)CC(=O)[O-].[Na+] |
| InChI | InChI=1S/C15H31NO3.Na/c1-3-4-5-6-7-8-9-10-11-14(17)12-16(2)13-15(18)19;/h14,17H,3-13H2,1-2H3,(H,18,19);/q;+1/p-1 |
| InChIKey | SVXRTIWJKQIFFV-UHFFFAOYSA-M |
| XLogP | -1.44 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|