C21H17N3O3 — CID 1023306
(4R)-2-amino-4-(2,5-dimethoxyphenyl)-6-phenyl-4H-pyran-3,5-dicarbonitrile (PubChem CID 1023306) has the molecular formula C21H17N3O3 and a molecular weight of 359.39 g/mol. Its IUPAC name is (4R)-2-amino-4-(2,5-dimethoxyphenyl)-6-phenyl-4H-pyran-3,5-dicarbonitrile.
| Compound Name | (4R)-2-amino-4-(2,5-dimethoxyphenyl)-6-phenyl-4H-pyran-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 1023306 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.39 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4R)-2-amino-4-(2,5-dimethoxyphenyl)-6-phenyl-4H-pyran-3,5-dicarbonitrile |
| SMILES | COc1ccc(OC)c([C@H]2C(C#N)=C(N)OC(c3ccccc3)=C2C#N)c1 |
| InChI | InChI=1S/C21H17N3O3/c1-25-14-8-9-18(26-2)15(10-14)19-16(11-22)20(13-6-4-3-5-7-13)27-21(24)17(19)12-23/h3-10,19H,24H2,1-2H3/t19-/m1/s1 |
| InChIKey | VGFLYAXYKWDWEY-LJQANCHMSA-N |
| XLogP | 3.45 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dhp_amino_CN_C(7)', 'substructure': 'N/A'} |
|---|