About 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid
6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid (PubChem CID 102330612) has the molecular formula C16H26O3
and a molecular weight of 266.38 g/mol. Its IUPAC name is 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid.
Molecular Properties
| Compound Name | 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid |
| PubChem CID | 102330612 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CCCCCC(=O)O |
| InChI | InChI=1S/C16H26O3/c1-2-3-5-9-14-13(11-12-15(14)17)8-6-4-7-10-16(18)19/h3,5,13-14H,2,4,6-12H2,1H3,(H,18,19)/b5-3-/t13-,14+/m0/s1 |
| InChIKey | WIJWBOWLVOOYFR-XEKFUKFUSA-N |
| XLogP | 3.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid?
The IUPAC name of 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid (CID 102330612) is 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid.
What is the SMILES notation for 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid?
The canonical SMILES for 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid is CC/C=C\C[C@H]1C(=O)CC[C@@H]1CCCCCC(=O)O.
What is the InChIKey of 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid?
The InChIKey is WIJWBOWLVOOYFR-XEKFUKFUSA-N. The full InChI is InChI=1S/C16H26O3/c1-2-3-5-9-14-13(11-12-15(14)17)8-6-4-7-10-16(18)19/h3,5,13-14H,2,4,6-12H2,1H3,(H,18,19)/b5-3-/t13-,14+/m0/s1.
What are the key properties of 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid?
6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid has a molecular weight of 266.38 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]hexanoic acid is sourced from PubChem (CID 102330612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).