C15H21NO2 — CID 102330721
(3R,4S)-1-benzyl-4-hydroxy-3,5,5-trimethylpiperidin-2-one (PubChem CID 102330721) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-4-hydroxy-3,5,5-trimethylpiperidin-2-one.
| Compound Name | (3R,4S)-1-benzyl-4-hydroxy-3,5,5-trimethylpiperidin-2-one |
|---|---|
| PubChem CID | 102330721 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | (3R,4S)-1-benzyl-4-hydroxy-3,5,5-trimethylpiperidin-2-one |
| SMILES | C[C@H]1C(=O)N(Cc2ccccc2)CC(C)(C)[C@H]1O |
| InChI | InChI=1S/C15H21NO2/c1-11-13(17)15(2,3)10-16(14(11)18)9-12-7-5-4-6-8-12/h4-8,11,13,17H,9-10H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | ZDYOKXPNUYYOJB-YPMHNXCESA-N |
| XLogP | 2.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |