About trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one
trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one (PubChem CID 102330787) has the molecular formula C12H22O
and a molecular weight of 182.31 g/mol. Its IUPAC name is trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one.
Molecular Properties
| Compound Name | trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one |
| PubChem CID | 102330787 |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.17 |
| IUPAC Name | trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one |
| SMILES | C[C@@H]1CC(C(C)(C)C)C[C@@H](C)C1=O |
| InChI | InChI=1S/C12H22O/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h8-10H,6-7H2,1-5H3/t8-,9-/m1/s1 |
| InChIKey | YNEYSORFAULDSN-RKDXNWHRSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one?
The IUPAC name of trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one (CID 102330787) is trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one.
What is the SMILES notation for trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one?
The canonical SMILES for trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one is C[C@@H]1CC(C(C)(C)C)C[C@@H](C)C1=O.
What is the InChIKey of trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one?
The InChIKey is YNEYSORFAULDSN-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H22O/c1-8-6-10(12(3,4)5)7-9(2)11(8)13/h8-10H,6-7H2,1-5H3/t8-,9-/m1/s1.
What are the key properties of trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one?
trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one has a molecular weight of 182.31 g/mol, XLogP of 3.28, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(2R,6R)-4-tert-butyl-2,6-dimethylcyclohexan-1-one is sourced from PubChem (CID 102330787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).