C10H16O4S2 — CID 102330892
(1R,4S,11S,14R)-3,12,15,16-tetraoxa-6,9-dithiatricyclo[9.3.1.14,14]hexadecane (PubChem CID 102330892) has the molecular formula C10H16O4S2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (1R,4S,11S,14R)-3,12,15,16-tetraoxa-6,9-dithiatricyclo[9.3.1.14,14]hexadecane.
| Compound Name | (1R,4S,11S,14R)-3,12,15,16-tetraoxa-6,9-dithiatricyclo[9.3.1.14,14]hexadecane |
|---|---|
| PubChem CID | 102330892 |
| Molecular Formula | C10H16O4S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | (1R,4S,11S,14R)-3,12,15,16-tetraoxa-6,9-dithiatricyclo[9.3.1.14,14]hexadecane |
| SMILES | C1CSC[C@H]2OC[C@H]3O[C@@H](CS1)OC[C@H]3O2 |
| InChI | InChI=1S/C10H16O4S2/c1-2-16-6-10-12-4-7-8(14-10)3-11-9(13-7)5-15-1/h7-10H,1-6H2/t7-,8-,9+,10+/m1/s1 |
| InChIKey | YNVJLHRXRIYMSI-IMSYWVGJSA-N |
| XLogP | 0.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |