C8H8Cl3NO3 — CID 102331023
(1R,4S,5S,6S)-1-methyl-6-nitro-5-(trichloromethyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 102331023) has the molecular formula C8H8Cl3NO3 and a molecular weight of 272.52 g/mol. Its IUPAC name is (1R,4S,5S,6S)-1-methyl-6-nitro-5-(trichloromethyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5S,6S)-1-methyl-6-nitro-5-(trichloromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 102331023 |
| Molecular Formula | C8H8Cl3NO3 |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | (1R,4S,5S,6S)-1-methyl-6-nitro-5-(trichloromethyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | C[C@]12C=C[C@H](O1)[C@@H](C(Cl)(Cl)Cl)[C@@H]2[N+](=O)[O-] |
| InChI | InChI=1S/C8H8Cl3NO3/c1-7-3-2-4(15-7)5(8(9,10)11)6(7)12(13)14/h2-6H,1H3/t4-,5+,6-,7+/m0/s1 |
| InChIKey | AGJZFKDZDSXPGX-BNHYGAARSA-N |
| XLogP | 2.35 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|