C35H47F5O5 — CID 10233150
11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)undecanoic acid (PubChem CID 10233150) has the molecular formula C35H47F5O5 and a molecular weight of 642.75 g/mol. Its IUPAC name is 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)undecanoic acid.
| Compound Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)undecanoic acid |
|---|---|
| PubChem CID | 10233150 |
| Molecular Formula | C35H47F5O5 |
| Molecular Weight | 642.75 g/mol |
| Exact Mass | 642.33 |
| IUPAC Name | 11-[7-hydroxy-3-(4-hydroxyphenyl)-3-propyl-2,4-dihydrochromen-4-yl]-2-(5,5,6,6,6-pentafluorohexyl)undecanoic acid |
| SMILES | CCCC1(c2ccc(O)cc2)COc2cc(O)ccc2C1CCCCCCCCCC(CCCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C35H47F5O5/c1-2-21-33(26-15-17-27(41)18-16-26)24-45-31-23-28(42)19-20-29(31)30(33)14-9-7-5-3-4-6-8-12-25(32(43)44)13-10-11-22-34(36,37)35(38,39)40/h15-20,23,25,30,41-42H,2-14,21-22,24H2,1H3,(H,43,44) |
| InChIKey | XGAGDXFLWNLAQW-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.75 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|