C16H25F8N2O+ — CID 102331602
[(Z)-3-(diethylamino)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)prop-2-enylidene]-diethylazanium (PubChem CID 102331602) has the molecular formula C16H25F8N2O+ and a molecular weight of 413.37 g/mol. Its IUPAC name is [(Z)-3-(diethylamino)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)prop-2-enylidene]-diethylazanium.
| Compound Name | [(Z)-3-(diethylamino)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)prop-2-enylidene]-diethylazanium |
|---|---|
| PubChem CID | 102331602 |
| Molecular Formula | C16H25F8N2O+ |
| Molecular Weight | 413.37 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | [(Z)-3-(diethylamino)-2-(2,2,3,3,4,4,5,5-octafluoropentoxy)prop-2-enylidene]-diethylazanium |
| SMILES | CCN(/C=C(/C=[N+](CC)CC)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)CC |
| InChI | InChI=1S/C16H25F8N2O/c1-5-25(6-2)9-12(10-26(7-3)8-4)27-11-14(19,20)16(23,24)15(21,22)13(17)18/h9-10,13H,5-8,11H2,1-4H3/q+1 |
| InChIKey | NNIALKCFXFCEKT-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|