About 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene
16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene (PubChem CID 102331830) has the molecular formula C17H31N2O+
and a molecular weight of 279.45 g/mol. Its IUPAC name is 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene.
Molecular Properties
| Compound Name | 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene |
| PubChem CID | 102331830 |
| Molecular Formula | C17H31N2O+ |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene |
| SMILES | Cc1n2cc[n+]1CCCCCCCCOCC2C(C)C |
| InChI | InChI=1S/C17H31N2O/c1-15(2)17-14-20-13-9-7-5-4-6-8-10-18-11-12-19(17)16(18)3/h11-12,15,17H,4-10,13-14H2,1-3H3/q+1 |
| InChIKey | LIMUMMPZKLMINW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 18.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene?
The IUPAC name of 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene (CID 102331830) is 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene.
What is the SMILES notation for 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene?
The canonical SMILES for 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene is Cc1n2cc[n+]1CCCCCCCCOCC2C(C)C.
What is the InChIKey of 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene?
The InChIKey is LIMUMMPZKLMINW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H31N2O/c1-15(2)17-14-20-13-9-7-5-4-6-8-10-18-11-12-19(17)16(18)3/h11-12,15,17H,4-10,13-14H2,1-3H3/q+1.
What are the key properties of 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene?
16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene has a molecular weight of 279.45 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 16-methyl-2-propan-2-yl-4-oxa-1-aza-13-azoniabicyclo[11.2.1]hexadeca-13(16),14-diene is sourced from PubChem (CID 102331830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).