About (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol
(1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol (PubChem CID 102331982) has the molecular formula C16H22O
and a molecular weight of 230.35 g/mol. Its IUPAC name is (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol.
Molecular Properties
| Compound Name | (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol |
| PubChem CID | 102331982 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol |
| SMILES | CC(C)=CCCC(C)(O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-14(2)8-7-12-16(3,17)13-11-15-9-5-4-6-10-15/h4-6,8-11,13,17H,7,12H2,1-3H3/b13-11+ |
| InChIKey | OJVURMQAOPQVKO-ACCUITESSA-N |
| XLogP | 4.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol?
The IUPAC name of (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol (CID 102331982) is (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol.
What is the SMILES notation for (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol?
The canonical SMILES for (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol is CC(C)=CCCC(C)(O)/C=C/c1ccccc1.
What is the InChIKey of (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol?
The InChIKey is OJVURMQAOPQVKO-ACCUITESSA-N. The full InChI is InChI=1S/C16H22O/c1-14(2)8-7-12-16(3,17)13-11-15-9-5-4-6-10-15/h4-6,8-11,13,17H,7,12H2,1-3H3/b13-11+.
What are the key properties of (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol?
(1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol has a molecular weight of 230.35 g/mol, XLogP of 4.20, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E)-3,7-dimethyl-1-phenylocta-1,6-dien-3-ol is sourced from PubChem (CID 102331982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).