C18H28O6 — CID 102332526
(5S,6S,7R,8R)-2,2-dimethyl-6,7,8-tris(prop-2-enoxy)-1,3,10-trioxaspiro[4.5]decane (PubChem CID 102332526) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is (5S,6S,7R,8R)-2,2-dimethyl-6,7,8-tris(prop-2-enoxy)-1,3,10-trioxaspiro[4.5]decane.
| Compound Name | (5S,6S,7R,8R)-2,2-dimethyl-6,7,8-tris(prop-2-enoxy)-1,3,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 102332526 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (5S,6S,7R,8R)-2,2-dimethyl-6,7,8-tris(prop-2-enoxy)-1,3,10-trioxaspiro[4.5]decane |
| SMILES | C=CCO[C@@H]1[C@H](OCC=C)CO[C@]2(COC(C)(C)O2)[C@H]1OCC=C |
| InChI | InChI=1S/C18H28O6/c1-6-9-19-14-12-22-18(13-23-17(4,5)24-18)16(21-11-8-3)15(14)20-10-7-2/h6-8,14-16H,1-3,9-13H2,4-5H3/t14-,15-,16+,18+/m1/s1 |
| InChIKey | GXQHMQBLGPPJPB-CBZIJGRNSA-N |
| XLogP | 2.21 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|