C14H17BrO5 — CID 102332802
(3S,4R,5R)-5-(6-bromo-4,4-dimethoxy-3-oxocyclohexa-1,5-dien-1-yl)-3,4-dimethyloxolan-2-one (PubChem CID 102332802) has the molecular formula C14H17BrO5 and a molecular weight of 345.19 g/mol. Its IUPAC name is (3S,4R,5R)-5-(6-bromo-4,4-dimethoxy-3-oxocyclohexa-1,5-dien-1-yl)-3,4-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-5-(6-bromo-4,4-dimethoxy-3-oxocyclohexa-1,5-dien-1-yl)-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 102332802 |
| Molecular Formula | C14H17BrO5 |
| Molecular Weight | 345.19 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | (3S,4R,5R)-5-(6-bromo-4,4-dimethoxy-3-oxocyclohexa-1,5-dien-1-yl)-3,4-dimethyloxolan-2-one |
| SMILES | COC1(OC)C=C(Br)C([C@@H]2OC(=O)[C@@H](C)[C@H]2C)=CC1=O |
| InChI | InChI=1S/C14H17BrO5/c1-7-8(2)13(17)20-12(7)9-5-11(16)14(18-3,19-4)6-10(9)15/h5-8,12H,1-4H3/t7-,8+,12-/m1/s1 |
| InChIKey | KSHJYZHNBYTXIX-RGNHYFCHSA-N |
| XLogP | 1.96 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|