C19H20Br3+ — CID 102333008
3-tert-butyl-1,5-dimethyl-6-[(2,4,6-tribromocyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-1,3-diene (PubChem CID 102333008) has the molecular formula C19H20Br3+ and a molecular weight of 488.08 g/mol. Its IUPAC name is 3-tert-butyl-1,5-dimethyl-6-[(2,4,6-tribromocyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-1,3-diene.
| Compound Name | 3-tert-butyl-1,5-dimethyl-6-[(2,4,6-tribromocyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 102333008 |
| Molecular Formula | C19H20Br3+ |
| Molecular Weight | 488.08 g/mol |
| Exact Mass | 484.91 |
| IUPAC Name | 3-tert-butyl-1,5-dimethyl-6-[(2,4,6-tribromocyclohexa-2,5-dien-1-ylidene)methylidene]cyclohexa-1,3-diene |
| SMILES | CC1=CC(C(C)(C)C)=C[C+](C)C1=C=C1C(Br)=CC(Br)C=C1Br |
| InChI | InChI=1S/C19H20Br3/c1-11-6-13(19(3,4)5)7-12(2)15(11)10-16-17(21)8-14(20)9-18(16)22/h6-9,14H,1-5H3/q+1 |
| InChIKey | PFLMGJFKRZPRPU-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.08 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|