About (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol
(1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol (PubChem CID 102333212) has the molecular formula C19H23NO
and a molecular weight of 281.40 g/mol. Its IUPAC name is (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol.
Molecular Properties
| Compound Name | (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol |
| PubChem CID | 102333212 |
| Molecular Formula | C19H23NO |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol |
| SMILES | CC(C)[C@H](O)c1cnc2cc(C#CC(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C19H23NO/c1-13(2)18(21)16-11-15-7-6-14(8-9-19(3,4)5)10-17(15)20-12-16/h6-7,10-13,18,21H,1-5H3/t18-/m0/s1 |
| InChIKey | HJTOYOBOGRVJDL-SFHVURJKSA-N |
| XLogP | 4.32 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol?
The IUPAC name of (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol (CID 102333212) is (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol.
What is the SMILES notation for (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol?
The canonical SMILES for (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol is CC(C)[C@H](O)c1cnc2cc(C#CC(C)(C)C)ccc2c1.
What is the InChIKey of (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol?
The InChIKey is HJTOYOBOGRVJDL-SFHVURJKSA-N. The full InChI is InChI=1S/C19H23NO/c1-13(2)18(21)16-11-15-7-6-14(8-9-19(3,4)5)10-17(15)20-12-16/h6-7,10-13,18,21H,1-5H3/t18-/m0/s1.
What are the key properties of (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol?
(1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol has a molecular weight of 281.40 g/mol, XLogP of 4.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[7-(3,3-dimethylbut-1-ynyl)quinolin-3-yl]-2-methylpropan-1-ol is sourced from PubChem (CID 102333212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).