C30H64O5Si3 — CID 102333493
[(2R,4R,5R,6R,10R,11S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 102333493) has the molecular formula C30H64O5Si3 and a molecular weight of 589.10 g/mol. Its IUPAC name is [(2R,4R,5R,6R,10R,11S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,4R,5R,6R,10R,11S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102333493 |
| Molecular Formula | C30H64O5Si3 |
| Molecular Weight | 589.10 g/mol |
| Exact Mass | 588.41 |
| IUPAC Name | [(2R,4R,5R,6R,10R,11S)-4,10-bis[[tert-butyl(dimethyl)silyl]oxy]-5,11-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](CO[Si](C)(C)C(C)(C)C)O[C@@]12OCC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2C |
| InChI | InChI=1S/C30H64O5Si3/c1-22-25(34-37(14,15)28(6,7)8)18-19-31-30(22)23(2)26(35-38(16,17)29(9,10)11)20-24(33-30)21-32-36(12,13)27(3,4)5/h22-26H,18-21H2,1-17H3/t22-,23+,24+,25+,26+,30+/m0/s1 |
| InChIKey | YTVPSNCFWOXGRC-NESMGORTSA-N |
| XLogP | 8.97 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.10 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|