C38H38F4N4O2 — CID 102333921
2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine (PubChem CID 102333921) has the molecular formula C38H38F4N4O2 and a molecular weight of 658.74 g/mol. Its IUPAC name is 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine.
| Compound Name | 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine |
|---|---|
| PubChem CID | 102333921 |
| Molecular Formula | C38H38F4N4O2 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine |
| SMILES | CCCCCCOc1c(F)c(-c2ccccn2)cc(-c2cnc(-c3cc(-c4ccccn4)c(F)c(OCCCCCC)c3F)cn2)c1F |
| InChI | InChI=1S/C38H38F4N4O2/c1-3-5-7-13-19-47-37-33(39)25(29-15-9-11-17-43-29)21-27(35(37)41)31-23-46-32(24-45-31)28-22-26(30-16-10-12-18-44-30)34(40)38(36(28)42)48-20-14-8-6-4-2/h9-12,15-18,21-24H,3-8,13-14,19-20H2,1-2H3 |
| InChIKey | MZJXVGGMJRXOJX-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|