About 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine
2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine (PubChem CID 102333921) has the molecular formula C38H38F4N4O2
and a molecular weight of 658.74 g/mol. Its IUPAC name is 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine.
Molecular Properties
| Compound Name | 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine |
| PubChem CID | 102333921 |
| Molecular Formula | C38H38F4N4O2 |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.29 |
| IUPAC Name | 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine |
| SMILES | CCCCCCOc1c(F)c(-c2ccccn2)cc(-c2cnc(-c3cc(-c4ccccn4)c(F)c(OCCCCCC)c3F)cn2)c1F |
| InChI | InChI=1S/C38H38F4N4O2/c1-3-5-7-13-19-47-37-33(39)25(29-15-9-11-17-43-29)21-27(35(37)41)31-23-46-32(24-45-31)28-22-26(30-16-10-12-18-44-30)34(40)38(36(28)42)48-20-14-8-6-4-2/h9-12,15-18,21-24H,3-8,13-14,19-20H2,1-2H3 |
| InChIKey | MZJXVGGMJRXOJX-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine?
The IUPAC name of 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine (CID 102333921) is 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine.
What is the SMILES notation for 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine?
The canonical SMILES for 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine is CCCCCCOc1c(F)c(-c2ccccn2)cc(-c2cnc(-c3cc(-c4ccccn4)c(F)c(OCCCCCC)c3F)cn2)c1F.
What is the InChIKey of 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine?
The InChIKey is MZJXVGGMJRXOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C38H38F4N4O2/c1-3-5-7-13-19-47-37-33(39)25(29-15-9-11-17-43-29)21-27(35(37)41)31-23-46-32(24-45-31)28-22-26(30-16-10-12-18-44-30)34(40)38(36(28)42)48-20-14-8-6-4-2/h9-12,15-18,21-24H,3-8,13-14,19-20H2,1-2H3.
What are the key properties of 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine?
2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine has a molecular weight of 658.74 g/mol, XLogP of 10.41, 16 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(2,4-difluoro-3-hexoxy-5-pyridin-2-ylphenyl)pyrazine is sourced from PubChem (CID 102333921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).