C14H21BO2S2 — CID 102333969
2-[(Z)-2-ethylsulfanyl-1-thiophen-2-ylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 102333969) has the molecular formula C14H21BO2S2 and a molecular weight of 296.27 g/mol. Its IUPAC name is 2-[(Z)-2-ethylsulfanyl-1-thiophen-2-ylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[(Z)-2-ethylsulfanyl-1-thiophen-2-ylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 102333969 |
| Molecular Formula | C14H21BO2S2 |
| Molecular Weight | 296.27 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 2-[(Z)-2-ethylsulfanyl-1-thiophen-2-ylethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCS/C=C(/B1OC(C)(C)C(C)(C)O1)c1cccs1 |
| InChI | InChI=1S/C14H21BO2S2/c1-6-18-10-11(12-8-7-9-19-12)15-16-13(2,3)14(4,5)17-15/h7-10H,6H2,1-5H3/b11-10+ |
| InChIKey | YAPGNMMNIYUTHH-ZHACJKMWSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|