C19H20INO4S — CID 102334191
methyl (E)-4-[(2-iodophenyl)methyl-(4-methylphenyl)sulfonylamino]but-2-enoate (PubChem CID 102334191) has the molecular formula C19H20INO4S and a molecular weight of 485.34 g/mol. Its IUPAC name is methyl (E)-4-[(2-iodophenyl)methyl-(4-methylphenyl)sulfonylamino]but-2-enoate.
| Compound Name | methyl (E)-4-[(2-iodophenyl)methyl-(4-methylphenyl)sulfonylamino]but-2-enoate |
|---|---|
| PubChem CID | 102334191 |
| Molecular Formula | C19H20INO4S |
| Molecular Weight | 485.34 g/mol |
| Exact Mass | 485.02 |
| IUPAC Name | methyl (E)-4-[(2-iodophenyl)methyl-(4-methylphenyl)sulfonylamino]but-2-enoate |
| SMILES | COC(=O)/C=C/CN(Cc1ccccc1I)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20INO4S/c1-15-9-11-17(12-10-15)26(23,24)21(13-5-8-19(22)25-2)14-16-6-3-4-7-18(16)20/h3-12H,13-14H2,1-2H3/b8-5+ |
| InChIKey | IAVZAENPHRQIGA-VMPITWQZSA-N |
| XLogP | 3.52 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|