C27H25FN2O2 — CID 102334281
1-benzyl-3-(4-fluoroanilino)-3-(2-oxocyclohexyl)indol-2-one (PubChem CID 102334281) has the molecular formula C27H25FN2O2 and a molecular weight of 428.51 g/mol. Its IUPAC name is 1-benzyl-3-(4-fluoroanilino)-3-(2-oxocyclohexyl)indol-2-one.
| Compound Name | 1-benzyl-3-(4-fluoroanilino)-3-(2-oxocyclohexyl)indol-2-one |
|---|---|
| PubChem CID | 102334281 |
| Molecular Formula | C27H25FN2O2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 1-benzyl-3-(4-fluoroanilino)-3-(2-oxocyclohexyl)indol-2-one |
| SMILES | O=C1CCCCC1C1(Nc2ccc(F)cc2)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C27H25FN2O2/c28-20-14-16-21(17-15-20)29-27(23-11-5-7-13-25(23)31)22-10-4-6-12-24(22)30(26(27)32)18-19-8-2-1-3-9-19/h1-4,6,8-10,12,14-17,23,29H,5,7,11,13,18H2 |
| InChIKey | CEHZHXJZBXNFOS-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |