C16H11F3 — CID 102334519
1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene (PubChem CID 102334519) has the molecular formula C16H11F3 and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene.
| Compound Name | 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene |
|---|---|
| PubChem CID | 102334519 |
| Molecular Formula | C16H11F3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene |
| SMILES | FC(F)(F)CC#Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H11F3/c17-16(18,19)12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14/h1-3,6-11H,12H2 |
| InChIKey | YHCRJYURJPOICP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|