About 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene
1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene (PubChem CID 102334519) has the molecular formula C16H11F3
and a molecular weight of 260.26 g/mol. Its IUPAC name is 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene.
Molecular Properties
| Compound Name | 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene |
| PubChem CID | 102334519 |
| Molecular Formula | C16H11F3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene |
| SMILES | FC(F)(F)CC#Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C16H11F3/c17-16(18,19)12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14/h1-3,6-11H,12H2 |
| InChIKey | YHCRJYURJPOICP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene?
The IUPAC name of 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene (CID 102334519) is 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene.
What is the SMILES notation for 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene?
The canonical SMILES for 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene is FC(F)(F)CC#Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene?
The InChIKey is YHCRJYURJPOICP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11F3/c17-16(18,19)12-4-5-13-8-10-15(11-9-13)14-6-2-1-3-7-14/h1-3,6-11H,12H2.
What are the key properties of 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene?
1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene has a molecular weight of 260.26 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-4-(4,4,4-trifluorobut-1-ynyl)benzene is sourced from PubChem (CID 102334519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).