C16H20N2O3 — CID 102335112
N,N-diethyl-1,5-dimethyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxamide (PubChem CID 102335112) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is N,N-diethyl-1,5-dimethyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxamide.
| Compound Name | N,N-diethyl-1,5-dimethyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxamide |
|---|---|
| PubChem CID | 102335112 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N,N-diethyl-1,5-dimethyl-2-oxospiro[indole-3,3'-oxirane]-2'-carboxamide |
| SMILES | CCN(CC)C(=O)C1OC12C(=O)N(C)c1ccc(C)cc12 |
| InChI | InChI=1S/C16H20N2O3/c1-5-18(6-2)14(19)13-16(21-13)11-9-10(3)7-8-12(11)17(4)15(16)20/h7-9,13H,5-6H2,1-4H3 |
| InChIKey | XIKPLASVUFVLJO-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 53.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|